| 2D Structure | |
| CID | 22814120 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;hydrate |
| InChI | InChI=1S/C6H12O6.H2O/c7-1-3(9)5(11)6(12)4(10)2-8;/h1,3-6,8-12H,2H2;1H2/t3-,4+,5+,6+;/m0./s1 |
| InChI Key | SPFMQWBKVUQXJV-BTVCFUMJSA-N |
| Canonical SMILES | None |
| Isomeric SMILES | None |
| Molecular Formula | C6H14O7 |
| Molecular Weight | 198.17 |
| synonyms | ['Dextrose monohydrate', 'Glucose Monohydrate', '77938-63-7', 'glucose hydrate', 'LX22YL083G', 'DIANEAL PD-1', 'DTXSID401015224', 'MultiBic component glucose monohydrate', 'Infant Dextrose', '5% Dextrose', 'Veterinary Dextrose', '10% Dextrose', '50% Dextrose', 'Sykes 5% Dextrose', '25% Dextrose Infant', 'RefChem:5740', 'Veterinary 5% Dextrose', 'Dextrose 50% Solution', 'D-Glucopyranose monohydrate', 'Alfa Veterinary 5% Dextrose', 'Alfa Veterinary 10% Dextrose', 'Alfa Veterinary 50% Dextrose', 'DTXCID401473549', 'D-Glucose monohydrate', 'D-Glucose, monohydrate', '(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;hydrate', 'MFCD00149450', '(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal hydrate', 'Dextrose Hydrous', 'UNII-LX22YL083G', 'glucose water', 'Dianeal PD-2', 'D-glucose,monohydrate', 'D-Glucose - monohydrate', 'D-glucose hydrate (1:1)', 'D-Glucose--water (1/1)', 'SCHEMBL65210', 'GLUCOSE HYDRATE [JAN]', 'SCHEMBL236816', 'DEXTROSE MONOHYDRATE [II]', 'D-GLUCOSE, HYDRATE (1:1)', 'GLUCOSE MONOHYDRATE [WHO-DD]', 'AKOS028109053', 'MG05194', 'GLUCOSE MONOHYDRATE [EP MONOGRAPH]', 'DB-230176', 'DEXTROSE MONOHYDRATE [USP MONOGRAPH]', 'Dextrose monohydrate, meets USP testing specifications', 'Q27283222', 'D-(+)-Glucose monohydrate, for microbiology, >=99.0%', 'D-(+)-Glucose monohydrate, tested according to Ph.Eur.', 'D-(+)-Glucose monohydrate, BioUltra, >=99.5% (HPLC)', 'Glucose monohydrate, EuropePharmacopoeia (EP) Reference Standard', 'D-(+)-Glucose monohydrate, meets analytical specification of Ph.??Eur., BP, Ph??Fran??., 7.0-9.5% water(Karl Fischer)'] |
From Pubchem